2-Furanacrylic acid, 5-nitro-, 2,2-bis(2-chloroethyl)hydrazide
(E)-N',N'-bis(2-chloroethyl)-3-(5-nitrofuran-2-yl)prop-2-enehydrazide
Also Known As: 5-Nitro-2-furanacrylic acid 2,2-bis(2-chloroethyl)hydrazide|2-FURANACRYLIC ACID, 5-NITRO-, 2,2-BIS(2-CHLOROETHYL)HYDRAZIDE|N',N'-bis(2-chloroethyl)-3-(5-nitrofuran-2-yl)prop-2-enehydrazide|(E)-N',N'-bis(2-chloroethyl)-3-(5-nitrofuran-2-yl)prop-2-enehydrazide|beta-(5-Nitrofuran-2-yl)acrylic acid N2,N2-bis(2-chloroethyl) hydrazide
| Molecular Formula | C11H13Cl2N3O4 |
|---|---|
| Molecular Weight | 321.02832 g/mol |
| LogP | 2.0118 |
| Topological Polar Surface Area | 88.62 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Exact Mass | 321.02832 |
| Monoisotopic Mass | 321.02832 |
| Heavy Atoms | 20 |
| Complexity | 483.76773 |
Chemical Identifiers
| CAS Number | 2007-46-7 |
|---|---|
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=C/C(=O)NN(CCCl)CCCl |
Product Overview
2-Furanacrylic acid, 5-nitro-, 2,2-bis(2-chloroethyl)hydrazide (CAS 2007-46-7), with molecular formula C11H13Cl2N3O4 and molecular weight 321.02832 g/mol. IUPAC: (E)-N',N'-bis(2-chloroethyl)-3-(5-nitrofuran-2-yl)prop-2-enehydrazide.
2-Furanacrylic acid, 5-nitro-, 2,2-bis(2-chloroethyl)hydrazide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »