3-(Pentafluorophenyl)propionic acid
3-(2,3,4,5,6-pentafluorophenyl)propanoic acid
Also Known As: 3-(Pentafluorophenyl)propionic acid|3-(Perfluorophenyl)propanoic acid|3-(pentafluorophenyl)propanoic acid|3- propionicacid|Penta-Fluorocinnamic Acid|3-Pentafluorophenylpropionic acid|3-(2,3,4,5,6-Pentafluorophenyl)propanoic acid|Benzenepropanoic acid, 2,3,4,5,6-pentafluoro-|Pentafluorophenylpropionic acid|3-(Perfluorophenyl)propanoicacid|3-Pentafluorophenyl-propionic acid|6753AD|3-(Perfluorophenyl)propanoic acid 97%|phenyl 2,2,3,3,3-pentafluoropropanoate|3-(Pentafluorophenyl)propionic acid 100g|3-(PENTAFLUOROPHENYL)PROPIONICACID|Hydrocinnamic acid, 2,3,4,5,6-pentafluoro-|Benzenepropanoic acid,2,3,4,5,6-pentafluoro-|Y-9136|3-(2,3,4,5,6-pentafluoro-phenyl)-propionic acid|3-(2,3,4,5,6-Pentafluorophenyl)propanoic acid #|I04-5228|Propanoic acid, 2,2,3,3,3-pentafluoro-, phenyl ester
| Molecular Formula | C9H5F5O2 |
|---|---|
| Molecular Weight | 240.02097 g/mol |
| LogP | 2.2 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Exact Mass | 240.02097 |
| Monoisotopic Mass | 240.02097 |
| Heavy Atoms | 16 |
| Complexity | 246.0 |
Chemical Identifiers
| CAS Number | 201224-92-2 |
|---|---|
| SMILES | C(CC(=O)O)C1=C(C(=C(C(=C1F)F)F)F)F |
| InChIKey | KBAMYOFXGBJADC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-(Pentafluorophenyl)propionic acid (CAS 201224-92-2), with molecular formula C9H5F5O2 and molecular weight 240.02097 g/mol. IUPAC: 3-(2,3,4,5,6-pentafluorophenyl)propanoic acid.