C28H23N3O2S
6-benzylsulfanyl-5-cyano-4-(4-methoxyphenyl)-2-methyl-N-phenylpyridine-3-carboxamide
Also Known As: BAS 00635114|AE-848/07783051|SR-01000393200-1|A0091/0003906|6-(benzylsulfanyl)-5-cyano-4-(4-methoxyphenyl)-2-methyl-N-phenylpyridine-3-carboxamide|6-(benzylthio)-5-cyano-4-(4-methoxyphenyl)-2-methyl-N-phenylnicotinamide|[5-cyano-4-(4-methoxyphenyl)-2-methyl-6-(phenylmethylthio)(3-pyridyl)]-N-benza mide|6-(benzylsulfanyl)-5-cyano-4-(4-methoxyphenyl)-2-methyl-N-phenylnicotinamide|6-Benzylsulfanyl-5-cyano-4-(4-methoxy-phenyl)-2-methyl-N-phenyl-nicotinamide
| Molecular Formula | C28H23N3O2S |
|---|---|
| Molecular Weight | 465.1511 g/mol |
| LogP | 6.4819 |
| Topological Polar Surface Area | 75.01 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 465.1511 |
| Monoisotopic Mass | 465.1511 |
| Heavy Atoms | 34 |
| Complexity | 1332.4376 |
Chemical Identifiers
| CAS Number | 201280-91-3 |
|---|---|
| SMILES | CC1=C(C(=C(C(=N1)SCC2=CC=CC=C2)C#N)C3=CC=C(C=C3)OC)C(=O)NC4=CC=CC=C4 |
Product Overview
C28H23N3O2S (CAS 201280-91-3), with molecular formula C28H23N3O2S and molecular weight 465.1511 g/mol. IUPAC: 6-benzylsulfanyl-5-cyano-4-(4-methoxyphenyl)-2-methyl-N-phenylpyridine-3-carboxamide.