N-(3-chloro-2-methylphenyl)-3-oxobutanamide
N-(3-chloro-2-methylphenyl)-3-oxobutanamide
Also Known As: N-(3-chloro-2-methylphenyl)-3-oxobutanamide|N- -3-oxobutyramide|Butanamide, N-(3-chloro-2-methylphenyl)-3-oxo-|3'-Chloro-ortho-acetoacetotoluidide|EINECS 243-539-9|5860AF|N-(3-Chloro-o-tolyl)-3-oxobutyramide|3 -Chloro-2 -methylacetoacetanilide|Methyl 3-amino-5-chloro-1-benzofuran-2-carboxylate|N-(3-chloro-2-methyl-phenyl)-3-oxo-butanamide|N-(3-Chloro-2-methylphenyl)-3-oxobutanimidic acid|SR-01000510047-1|3-Amino-5-chloro-benzofuran-2-carboxylic acid methyl ester
| Molecular Formula | C11H12ClNO2 |
|---|---|
| Molecular Weight | 225.05565 g/mol |
| LogP | 2.2 |
| Topological Polar Surface Area | 46.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 225.05565 |
| Monoisotopic Mass | 225.05565 |
| Heavy Atoms | 15 |
| Complexity | 255.0 |
Chemical Identifiers
| CAS Number | 20139-54-2 |
|---|---|
| SMILES | CC1=C(C=CC=C1Cl)NC(=O)CC(=O)C |
| InChIKey | NBLAONBKZUTBFR-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N-(3-chloro-2-methylphenyl)-3-oxobutanamide (CAS 20139-54-2), with molecular formula C11H12ClNO2 and molecular weight 225.05565 g/mol. IUPAC: N-(3-chloro-2-methylphenyl)-3-oxobutanamide.