4-Acetamidobenzenesulfonanilide
N-[4-(phenylsulfamoyl)phenyl]acetamide
Also Known As: N-[4-(phenylsulfamoyl)phenyl]acetamide|N-(4-(N-Phenylsulfamoyl)phenyl)acetamide|N4-acetylsulfanilylanilide|Oprea1_697555|Oprea1_731874|Acetamide, N-[4-[(phenylamino)sulfonyl]phenyl]-|4-ACETAMIDOBENZENESULFONANILIDE|N-[4-(anilinosulfonyl)phenyl]acetamide|4-Acetamido-N-phenylbenzenesulfonamide|acetamide,n-[4-[(phenylamino)sulfonyl]phenyl]-|N-[4-[(phenylamino)sulfonyl]phenyl]acetamide|AE-641/00377026|666-445-3
| Molecular Formula | C14H14N2O3S |
|---|---|
| Molecular Weight | 290.0725 g/mol |
| LogP | 1.4 |
| Topological Polar Surface Area | 83.7 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 290.0725 |
| Monoisotopic Mass | 290.0725 |
| Heavy Atoms | 20 |
| Complexity | 416.0 |
Chemical Identifiers
| CAS Number | 2080-33-3 |
|---|---|
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2 |
| InChIKey | GDPQDWYHZBUJTA-UHFFFAOYSA-N |
Product Overview
4-Acetamidobenzenesulfonanilide (CAS 2080-33-3), with molecular formula C14H14N2O3S and molecular weight 290.0725 g/mol. IUPAC: N-[4-(phenylsulfamoyl)phenyl]acetamide.
4-Acetamidobenzenesulfonanilide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »