1-Azido-4-methylbenzene
1-azido-4-methylbenzene
Also Known As: 1-Azido-4-methylbenzene|p-Tolyl azide|4-Azidotoluene|p-Azidotoluene|Toluene, p-azido-|Benzene, 1-azido-4-methyl-|4-Methylphenyl azide|4-Azido-toluol|4-Tolyl azide|4-Azidotoluene solution|p-Methylphenyl azide|4-methyl-phenylazide|p-Tolyl azide solution|1-azido-4-methyl-benzene|(4-Methylphenyl) azide|1-Methyl-4-azidobenzene|4-Methyl-1-azidobenzene|4-Methylphenyl azide solution|1-Azido-4-methylbenzene solution|F2157-0461|4-Azidotoluene solution, ~0.5 M in tert-butyl methyl ether, >=95.0% (HPLC)|664-281-7
| Molecular Formula | C7H7N3 |
|---|---|
| Molecular Weight | 133.064 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 14.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 133.064 |
| Monoisotopic Mass | 133.064 |
| Heavy Atoms | 10 |
| Complexity | 141.0 |
Chemical Identifiers
| CAS Number | 2101-86-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)N=[N+]=[N-] |
| InChIKey | YVXDRCDGBCOJHX-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1-Azido-4-methylbenzene (CAS 2101-86-2), with molecular formula C7H7N3 and molecular weight 133.064 g/mol. IUPAC: 1-azido-4-methylbenzene.