![2-[4-(4-Chlorobenzoyl)-1-piperazinyl]phenyl methyl ether structure](/static/products/2109/21091-80-5.webp)
2-[4-(4-Chlorobenzoyl)-1-piperazinyl]phenyl methyl ether
(4-chlorophenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone
Also Known As: Oprea1_072664|Oprea1_476607|CBDivE_013907|2-[4-(4-chlorobenzoyl)-1-piperazinyl]phenyl methyl ether|AB00078715-01|AG-670/34987028|SR-01000420574-1|(4-chlorophenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone|(4-chlorophenyl)[4-(2-methoxyphenyl)piperazino]methanone|1-(4-CHLOROBENZOYL)-4-(2-METHOXYPHENYL)PIPERAZINE|(4-chlorophenyl)[4-(2-methoxyphenyl)piperazin-1-yl]methanone
| Molecular Formula | C18H19ClN2O2 |
|---|---|
| Molecular Weight | 330.1135 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 32.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 330.1135 |
| Monoisotopic Mass | 330.1135 |
| Heavy Atoms | 23 |
| Complexity | 390.0 |
Chemical Identifiers
| CAS Number | 21091-80-5 |
|---|---|
| SMILES | COC1=CC=CC=C1N2CCN(CC2)C(=O)C3=CC=C(C=C3)Cl |
| InChIKey | FQNANCZTXOXWJC-UHFFFAOYSA-N |
Product Overview
2-[4-(4-Chlorobenzoyl)-1-piperazinyl]phenyl methyl ether (CAS 21091-80-5), with molecular formula C18H19ClN2O2 and molecular weight 330.1135 g/mol. IUPAC: (4-chlorophenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
2-[4-(4-Chlorobenzoyl)-1-piperazinyl]phenyl methyl ether is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »