Ethyl 2-(4-allyl-2-methoxyphenoxy)acetate
ethyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate
Also Known As: ethyl 2-(4-allyl-2-methoxyphenoxy)acetate|Oprea1_157040|ethyl (4-allyl-2-methoxyphenoxy)acetate|ethyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate|ethyl2-(4-allyl-2-methoxyphenoxy)acetate|ethyl 2-(4-allyl-2-methoxy-phenoxy)acetate|ethyl 2-methoxy-4-(2-propenyl)phenoxyacetate|J1.085.616G|(4-Allyl-2-methoxy-phenoxy)-acetic acid ethyl ester|ETHYL 2-[2-METHOXY-4-(PROP-2-EN-1-YL)PHENOXY]ACETATE|2-Methoxy-4-(2-propenyl)phenoxyacetic acid ethyl ester|(4-Allyl-2-methoxy-phenoxy)-essigsaeure-aethylester|SR-01000216272-1|ethyl 2-2-methoxy-4-(prop-2-en-1-yl)phenoxyacetate
| Molecular Formula | C14H18O4 |
|---|---|
| Molecular Weight | 250.12051 g/mol |
| LogP | 2.3656 |
| Topological Polar Surface Area | 44.76 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 250.12051 |
| Monoisotopic Mass | 250.12051 |
| Heavy Atoms | 18 |
| Complexity | 412.25507 |
Chemical Identifiers
| CAS Number | 212775-06-9 |
|---|---|
| SMILES | CCOC(=O)COC1=C(C=C(C=C1)CC=C)OC |
Product Overview
Ethyl 2-(4-allyl-2-methoxyphenoxy)acetate (CAS 212775-06-9), with molecular formula C14H18O4 and molecular weight 250.12051 g/mol. IUPAC: ethyl 2-(2-methoxy-4-prop-2-enylphenoxy)acetate.