2-(Triphenyl-lambda~5~-phosphanylidene)cyclopentan-1-one
2-(triphenyl-λ5-phosphanylidene)cyclopentan-1-one
Also Known As: 2-(triphenyl-|2-oxocyclopentylidenetriphenylphosphorane|2-ketocyclopentylidenetriphenylphosphorane|2-(Triphenylphosphonio)cyclopentene-1-olate|2-(triphenylphosphoranylidene)cyclopentanone|2-triphenylphosphoranylidenecyclopentan-1-one|2-(Triphenyl-lambda~5~-phosphanylidene)cyclopentan-1-one|(2-oxidocyclopent-1-en-1-yl)triphenylphosphanium|2-(triphenyl-|E5-phosphanylidene)cyclopentan-1-one|2-(triphenyl-lambda5-phosphanylidene)cyclopentan-1-one
| Molecular Formula | C23H21OP |
|---|---|
| Molecular Weight | 344.133 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 344.133 |
| Monoisotopic Mass | 344.133 |
| Heavy Atoms | 25 |
| Complexity | 464.0 |
Chemical Identifiers
| CAS Number | 2136-76-7 |
|---|---|
| SMILES | C1CC(=O)C(=P(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C1 |
| InChIKey | CVPGAJURWPTFCB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(Triphenyl-lambda~5~-phosphanylidene)cyclopentan-1-one (CAS 2136-76-7), with molecular formula C23H21OP and molecular weight 344.133 g/mol. IUPAC: 2-(triphenyl-λ5-phosphanylidene)cyclopentan-1-one.
2-(Triphenyl-lambda~5~-phosphanylidene)cyclopentan-1-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »