1,2-Benzenedicarboperoxoic acid, 1,2-bis(1,1-dimethylethyl) ester
ditert-butyl benzene-1,2-dicarboperoxoate
Also Known As: Perbutyl MA|Kayaester PH|Di-tert-butyl diperoxyphthalate|Lupersol KDB|Trigonox 111|Di-tert-butyl diperphthalate|Di-tert-butyl perphthalate|tert-Butyl diperphthalate|Di-t-butyl peroxyphthalate|di-t-butyl diperoxyphthalate|di-tert-butyldiperoxyphthalate|Di-(tert-butylperoxy)phthalate|Peroxyphthalic acid, di-tert-butyl ester|1, bis(1,1-dimethylethyl) ester|di-tert-butyl benzene-1,2-dicarboperoxoate|EINECS 218-454-5|ditert-butyl benzene-1,2-dicarboperoxoate|Di-(terc-butilperoxi)ftalato [Spanish]|Diperoxyphtalate de tert-butyle [French]|Diperoxyphthalic acid di-tert-butyl ester|1,2-Benzenedicarboperoxoic acid di(tert-butyl)|Diperoxyphthalic acid, di-tert-butyl ester|Di(tert-butyl) 1,2-benzenedicarboperoxoate #|Di-per-phthalsA currencyure-di-tert.-butylester|1,2-Benzenedicarboperoxoic acid, 1,2-bis(1,1-dimethylethyl) ester|1,2-Benzenedicarboperoxoic acid, bis(1,1-dimethylethyl) ester|1,2-Benzenedicarboperoxoicacid, 1,2-bis(1,1-dimethylethyl) ester|DI-tert-BUTYL DIPERPHTHALATE, 50% SOLN. IN DBP
| Molecular Formula | C16H22O6 |
|---|---|
| Molecular Weight | 310.14163 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 71.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Exact Mass | 310.14163 |
| Monoisotopic Mass | 310.14163 |
| Heavy Atoms | 22 |
| Complexity | 352.0 |
Chemical Identifiers
| CAS Number | 2155-71-7 |
|---|---|
| SMILES | CC(C)(C)OOC(=O)C1=CC=CC=C1C(=O)OOC(C)(C)C |
| InChIKey | QZYRMODBFHTNHF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 15 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,2-Benzenedicarboperoxoic acid, 1,2-bis(1,1-dimethylethyl) ester (CAS 2155-71-7), with molecular formula C16H22O6 and molecular weight 310.14163 g/mol. IUPAC: ditert-butyl benzene-1,2-dicarboperoxoate.