1,2,3,4,6,7-Tribenzophenazine
15,26-diazahexacyclo[12.12.0.02,7.08,13.016,25.017,22]hexacosa-1(26),2,4,6,8,10,12,14,16(25),17,19,21,23-tridecaene
Also Known As: Tribenzo[a,c,h]phenazine|tribenzo phenazine|9,c,h]anthracene|Tribenzo[a,h]phenazine|1,2,3,4,6,7-Tribenzophenazine|1,2:3,4:6,7-Tribenzophenazine|1,3,4,6,7-Tribenzophenazine|AF-407/09202015|15,26-diazahexacyclo[12.12.0.02,7.08,13.016,25.017,22]hexacosa-1(14),2,4,6,8,10,12,15,17,19,21,23,25-tridecaene|633-671-9
| Molecular Formula | C24H14N2 |
|---|---|
| Molecular Weight | 330.1157 g/mol |
| LogP | 6.4 |
| Topological Polar Surface Area | 25.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 330.1157 |
| Monoisotopic Mass | 330.1157 |
| Heavy Atoms | 26 |
| Complexity | 518.0 |
Chemical Identifiers
| CAS Number | 216-01-3 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C=CC3=C2N=C4C5=CC=CC=C5C6=CC=CC=C6C4=N3 |
| InChIKey | MAOGUGQCDLRFTD-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,2,3,4,6,7-Tribenzophenazine (CAS 216-01-3), with molecular formula C24H14N2 and molecular weight 330.1157 g/mol. IUPAC: 15,26-diazahexacyclo[12.12.0.02,7.08,13.016,25.017,22]hexacosa-1(26),2,4,6,8,10,12,14,16(25),17,19,21,23-tridecaene.