Cyclohexyl-(2-diethoxyphosphorylsulfanylethyl)-dimethylazanium;methyl sulfate
cyclohexyl-(2-diethoxyphosphorylsulfanylethyl)-dimethylazanium;methyl sulfate
Also Known As: GT165|GT 165|GT-165|cyclohexyl-(2-diethoxyphosphorylsulfanylethyl)-dimethylazanium;methyl sulfate|N-(2-((Diethoxyphosphinyl)thio)ethyl)-N,N-dimethylcyclohexanaminium, methyl sulfate|cyclohexyl-(2-diethoxyphosphorylsulfanylethyl)-dimethylazanium; methyl sulfate|N-{2-[(diethoxyphosphoryl)sulfanyl]ethyl}-N,N-dimethylcyclohexanaminium methyl sulfate|Phosphorothioic acid, O,O-diethyl ester, S-ester with cyclohexyl(2-mercaptoethyl)dimethylammonium methyl sulfate
| Molecular Formula | C15H34NO7PS2 |
|---|---|
| Molecular Weight | 435.15143 g/mol |
| LogP | 3.4028 |
| Topological Polar Surface Area | 136.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Exact Mass | 435.15143 |
| Monoisotopic Mass | 435.15143 |
| Heavy Atoms | 26 |
| Complexity | 400.0 |
Chemical Identifiers
| CAS Number | 2170-13-0 |
|---|---|
| SMILES | CCOP(=O)(OCC)SCC[N+](C)(C)C1CCCCC1.COS(=O)(=O)[O-] |
| InChIKey | UGNIYPDYAVEHPB-UHFFFAOYSA-M |
Product Overview
Cyclohexyl-(2-diethoxyphosphorylsulfanylethyl)-dimethylazanium;methyl sulfate (CAS 2170-13-0), with molecular formula C15H34NO7PS2 and molecular weight 435.15143 g/mol. IUPAC: cyclohexyl-(2-diethoxyphosphorylsulfanylethyl)-dimethylazanium;methyl sulfate.