Benzoic acid, 3,5-dibromo-2-hydroxy-, methyl ester
methyl 3,5-dibromo-2-hydroxybenzoate
Also Known As: Methyl 3,5-dibromo-2-hydroxybenzoate|ACMC-1CPM5|TIMTEC-BB SBB001273|3-bromo-4-hydroxyacetophenone|METHYL 3,5-DIBROMOSALICYLATE|RARECHEM AL BF 0030|7385AD|3,5-dibromo-2-hydroxymethyl benzoate|Benzoic acid, 3,5-dibromo-2-hydroxy-, methyl ester|methyl 3,5-dibromo-2-hydroxy-benzoate|Methyl 3,5-dibromo-2-hydroxybenzoate #|NCGC00332169-01|METHYL3,5-DIBROMO-2-HYDROXYBENZOATE|3,5-DIBROMO-2-HYDROXYBENZOIC ACID METHYL ESTER|3,5-Dibrom-2-hydroxy-benzoesaeure-methylester|?METHYL 3,5-DIBROMO-2-HYDROXYBENZOATE|AB01326200-02
| Molecular Formula | C8H6Br2O3 |
|---|---|
| Molecular Weight | 307.86838 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 307.86838 |
| Monoisotopic Mass | 307.86838 |
| Heavy Atoms | 13 |
| Complexity | 198.0 |
Chemical Identifiers
| CAS Number | 21702-79-4 |
|---|---|
| SMILES | COC(=O)C1=C(C(=CC(=C1)Br)Br)O |
| InChIKey | KISQISIKTRRMOX-UHFFFAOYSA-N |
Product Overview
Benzoic acid, 3,5-dibromo-2-hydroxy-, methyl ester (CAS 21702-79-4), with molecular formula C8H6Br2O3 and molecular weight 307.86838 g/mol. IUPAC: methyl 3,5-dibromo-2-hydroxybenzoate.