Phoxim, (E)-
(E)-N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide
Also Known As: PHOXIM|Baythion|Phoxime|(E)-Phoxim|Phoximum|Valexone|Sebacil|Valexon|Volaton|Foxima|Phoxim, (E)-|Phoxim Impurity 5|Phoxim [BAN:INN]|Phoxim [INN:BAN]|Caswell No. 902L|Foxima [INN-Spanish]|Phoxime [INN-French]|Phoxime [ISO-French]|Phoximum [INN-Latin]|starbld0009640|Bayer 77488|BAY sra 7502|BAY 77488|BAY 5621|HY-B0819|OMS 1170|SRA 7502|EINECS 238-887-3|ENT 27488|EPA Pesticide Chemical Code 598800|alpha-(((Diethoxyphosphinothioyl)oxy)imino)benzeneacetonitrile|(E)-N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide|S281|AI3-27448|O,O-Diethyl-alpha-cyanobenzylidineaminooxyphosphonothiate
| Molecular Formula | C12H15N2O3PS |
|---|---|
| Molecular Weight | 298.0541 g/mol |
| LogP | 3.22838 |
| Topological Polar Surface Area | 63.84 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Exact Mass | 298.0541 |
| Monoisotopic Mass | 298.0541 |
| Heavy Atoms | 19 |
| Complexity | 503.4558 |
Chemical Identifiers
| CAS Number | 217075-81-5 |
|---|---|
| SMILES | CCOP(=S)(OCC)O/N=C(/C#N)\C1=CC=CC=C1 |
Product Overview
Phoxim, (E)- (CAS 217075-81-5), with molecular formula C12H15N2O3PS and molecular weight 298.0541 g/mol. IUPAC: (E)-N-diethoxyphosphinothioyloxybenzenecarboximidoyl cyanide.