P-(4-Nitrophenyl)phosphonic acid
(4-nitrophenyl)phosphonic acid
Also Known As: (4-Nitrophenyl)phosphonic acid|4-Nitrophenyl phosphonate|(p-Nitrophenyl)phosphonic acid|p-nitrophenyl phosphonate|-PHOSPHONICACID|4-nitrophenylphosphonic acid|P-(4-Nitrophenyl)phosphonic acid|Phosphonic acid, (p-nitrophenyl)-|Phosphonic acid, (4-nitrophenyl)-|Phosphonic acid,P-(4-nitrophenyl)-|CHLOROMETHYLDIMETHYLCHLOROSILANE|Phosphonic acid, P-(4-nitrophenyl)-|(4-NITRO-PHENYL)-PHOSPHONICACID|(4-NITRO-PHENYL)-PHOSPHONIC ACID|4-16-00-01084 (Beilstein Handbook Reference)|AL-398/40000850
| Molecular Formula | C6H6NO5P |
|---|---|
| Molecular Weight | 202.99835 g/mol |
| LogP | -0.2 |
| Topological Polar Surface Area | 103.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 202.99835 |
| Monoisotopic Mass | 202.99835 |
| Heavy Atoms | 13 |
| Complexity | 236.0 |
Chemical Identifiers
| CAS Number | 2175-86-2 |
|---|---|
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])P(=O)(O)O |
| InChIKey | CBWCNKVANCTCAD-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 14 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
P-(4-Nitrophenyl)phosphonic acid (CAS 2175-86-2), with molecular formula C6H6NO5P and molecular weight 202.99835 g/mol. IUPAC: (4-nitrophenyl)phosphonic acid.