3-Methyl-4-phenyl-3-buten-2-one oxime
(NE)-N-[(E)-3-methyl-4-phenylbut-3-en-2-ylidene]hydroxylamine
Also Known As: alpha-Methylbenzylideneacetone oxime|3-Methyl-4-phenyl-3-buten-2-one oxime|3-Buten-2-one, 3-methyl-4-phenyl-, oxime|.ALPHA.-METHYLBENZYLIDENEACETONE OXIME|NCGC00176271-01|4-phenyl-3-methyl-3-butene-2-one oxime|3-Methyl-4-phenyl-but-3-en-2-one oxime|(2E,3E)-3-methyl-4-phenylbut-3-en-2-one oxime|(2E,3E)-3-Methyl-4-phenyl-3-buten-2-one oxime #|BRD-K78126581-001-01-0|2-(1,2-dibromopropyl)-4,5-methylenedioxy-1-bromobenzene|(NE)-N-[(E)-3-methyl-4-phenylbut-3-en-2-ylidene]hydroxylamine|(NZ)-N-[(E)-3-methyl-4-phenylbut-3-en-2-ylidene]hydroxylamine
| Molecular Formula | C11H13NO |
|---|---|
| Molecular Weight | 175.09972 g/mol |
| LogP | 2.94 |
| Topological Polar Surface Area | 32.59 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 175.09972 |
| Monoisotopic Mass | 175.09972 |
| Heavy Atoms | 13 |
| Complexity | 325.20334 |
Chemical Identifiers
| CAS Number | 21791-89-9 |
|---|---|
| SMILES | C/C(=C\C1=CC=CC=C1)/C(=N/O)/C |
Product Overview
3-Methyl-4-phenyl-3-buten-2-one oxime (CAS 21791-89-9), with molecular formula C11H13NO and molecular weight 175.09972 g/mol. IUPAC: (NE)-N-[(E)-3-methyl-4-phenylbut-3-en-2-ylidene]hydroxylamine.