1-(4-Methylbenzenesulfonyl)-4-methylidenepiperidine
4-methylidene-1-(4-methylphenyl)sulfonylpiperidine
Also Known As: 1-Tosyl-4-methylenepiperidine|4-methylene-1-tosylpiperidine|1-(4-methylbenzenesulfonyl)-4-methylidenepiperidine|1-(4-Methylphenylsulfonyl)-4-methylenepiperidine|4-methylidene-1-(4-methylphenyl)sulfonylpiperidine|4-methylidene-1-(4-methylphenyl)sulfonyl-piperidine|1-[(4-methylbenzene)sulfonyl]-4-methylidenepiperidine|4-METHYLENE-1-(TOLUENE-4-SULFONYL)-PIPERIDINE
| Molecular Formula | C13H17NO2S |
|---|---|
| Molecular Weight | 251.098 g/mol |
| LogP | 2.33572 |
| Topological Polar Surface Area | 37.38 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 251.098 |
| Monoisotopic Mass | 251.098 |
| Heavy Atoms | 17 |
| Complexity | 506.85538 |
Chemical Identifiers
| CAS Number | 2181-21-7 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(=C)CC2 |
Product Overview
1-(4-Methylbenzenesulfonyl)-4-methylidenepiperidine (CAS 2181-21-7), with molecular formula C13H17NO2S and molecular weight 251.098 g/mol. IUPAC: 4-methylidene-1-(4-methylphenyl)sulfonylpiperidine.
1-(4-Methylbenzenesulfonyl)-4-methylidenepiperidine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »