2-(Pentafluorophenoxy)ethanol
2-(2,3,4,5,6-pentafluorophenoxy)ethanol
Also Known As: 2-(Pentafluorophenoxy)ethanol|2-Pentafluorophenoxyethanol|2-(Perfluorophenoxy)ethanol|2-(2,3,4,5,6-Pentafluorophenoxy)ethanol|ACMC-209fpj|timtec-bb sbb006617|PIGMENT RED 13|2-(Pentafluorophenoxy)ethan-1-ol|2-(Pentafluorophenoxy)ethanol 500g|2-(Pentafluorophenoxy)ethanol, 96%|7460AD|2-(2,3,4,5,6-pentafluorophenoxy)ethan-1-ol|J1.387.614B|2-(2,3,4,5,6-Pentafluorophenoxy)ethanol #|2-(2,3,4,5,6-pentafluorophenoxy)ethanol,93%|192P554|I14-29655|2-(2,3,4,5,6-PENTAFLUOROPHENOXY)ETHANOL,90-93%,TECH.|2-(Pentafluorophenoxy)ethanol, 2-Pentafluorophenoxyethanol, 458112_ALDRICH, MolPort-001-771-383, ZINC02556850, CID603435, BBV-25470846, 2-(2,3,4,5,6-Pentafluorophenoxy)ethanol, P1225, 2192-55-4|620-664-0
| Molecular Formula | C8H5F5O2 |
|---|---|
| Molecular Weight | 228.02097 g/mol |
| LogP | 1.7 |
| Topological Polar Surface Area | 29.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Exact Mass | 228.02097 |
| Monoisotopic Mass | 228.02097 |
| Heavy Atoms | 15 |
| Complexity | 189.0 |
Chemical Identifiers
| CAS Number | 2192-55-4 |
|---|---|
| SMILES | C(COC1=C(C(=C(C(=C1F)F)F)F)F)O |
| InChIKey | NPVVUYMVRISVGK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(Pentafluorophenoxy)ethanol (CAS 2192-55-4), with molecular formula C8H5F5O2 and molecular weight 228.02097 g/mol. IUPAC: 2-(2,3,4,5,6-pentafluorophenoxy)ethanol.