Ethyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate
ethyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate
Also Known As: Ethyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate|Ethyl 3,4,5-trimethylpyrrole-2-carboxylate|ACMC-20al0b|Maybridge1_001943|HMS547A07|2,3,4-Trimethyl-5-carbethoxy-pyrrole|ETHYL 3,4,5-TRIMETHYL-2-PYRROLECARBOXYLATE|Ethyl3,4,5-trimethyl-1H-pyrrole-2-carboxylate|1H-Pyrrole-2-carboxylic acid, 3,4,5-trimethyl-, ethyl ester|3,4,5-Trimethyl-pyrrol-2-carbonsaeure-aethylester|ETHYL3,4,5-TRIMETHYLPYRROLE-2-CARBOXYLATE|SR-01000500434-1|?ETHYL 3,4,5-TRIMETHYLPYRROLE-2-CARBOXYLATE|1H-Pyrrole-2-carboxylic acid, 3,4,5-trimethyl, ethyl ester|3,4,5-Trimethylpyrrole-2-carboxylic acid ethyl ester
| Molecular Formula | C10H15NO2 |
|---|---|
| Molecular Weight | 181.11028 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 42.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 181.11028 |
| Monoisotopic Mass | 181.11028 |
| Heavy Atoms | 13 |
| Complexity | 193.0 |
Chemical Identifiers
| CAS Number | 2199-46-4 |
|---|---|
| SMILES | CCOC(=O)C1=C(C(=C(N1)C)C)C |
| InChIKey | WBOGFZDTCIQHSX-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate (CAS 2199-46-4), with molecular formula C10H15NO2 and molecular weight 181.11028 g/mol. IUPAC: ethyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate.