![2-[(3,4-Dichlorophenoxy)methyl]oxirane structure](/static/products/2212/2212-07-9.webp)
2-[(3,4-Dichlorophenoxy)methyl]oxirane
2-[(3,4-dichlorophenoxy)methyl]oxirane
Also Known As: 2-[(3,4-dichlorophenoxy)methyl]oxirane|3-Amino-butan-1-ol|2-((3,4-Dichlorophenoxy)methyl)oxirane|2-(3,4-dichlorophenoxymethyl)oxirane|(3,4-dichloro-phenoxymethyl)-oxirane|Propane, 1-(2,4-dichlorophenoxy)-|2-(3,4-Dichlorophenoxy)methyloxirane|2-(3,4-dichloro-phenoxymethyl)-oxirane|NCGC00665374-01|2,3-Epoxypropyl 3,4-dichlorophenyl ether|1,2-dichloro-4-(oxiran-2-ylmethoxy)benzene|Oxirane, 2-[(3,4-dichlorophenoxy)methyl]-|K-6117|3-(3,4-Dichlorophenoxy)-1,2-propenoxide, 3-(3,4-Dichlorophenoxy)-1,2-epoxypropane|959-658-0
| Molecular Formula | C9H8Cl2O2 |
|---|---|
| Molecular Weight | 217.99013 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 21.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 217.99013 |
| Monoisotopic Mass | 217.99013 |
| Heavy Atoms | 13 |
| Complexity | 177.0 |
Chemical Identifiers
| CAS Number | 2212-07-9 |
|---|---|
| SMILES | C1C(O1)COC2=CC(=C(C=C2)Cl)Cl |
| InChIKey | NRLJEEOYPXGFOM-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-[(3,4-Dichlorophenoxy)methyl]oxirane (CAS 2212-07-9), with molecular formula C9H8Cl2O2 and molecular weight 217.99013 g/mol. IUPAC: 2-[(3,4-dichlorophenoxy)methyl]oxirane.