(E)-9-Octadecenoic acid butyl ester
butyl (E)-octadec-9-enoate
Also Known As: Butyl oleate|butyl elaidate|Bytyl oleate|Kesscoflex BO|n-Butyl oleate|Uniflex BYO|Advaplast 42|Vinicizer 30|Plasthall 503|Plasthall 914|Wilmar Butyl Oleate|Witcizer 100|Witcizer 101|butyl octadec-9-enoate|Butyl 9-octadecenoate|Kessco 554|Hallco C 503|elaidic acid butyl ester|Advaplast 42 (VAN)|Butyl cis-9-octadecenoate|Elaidic acid, butyl ester|(Oleic acid, butyl ester)|Hallco C-503 Plasticizer|butyl (E)-octadec-9-enoate|Octadecenoic acid, butyl ester|(E)-9-Octadecenoic acid butyl ester|9-Octadecenoic acid butyl ester|OLEIC ACID, BUTYL ESTER|9-Octadecenoic acid, butyl ester|EINECS 205-559-6|9-Octadecenoic acid (Z)-, butyl ester|9-Octadecenoic acid, butyl ester (cis)|9-Octadecenoic acid, butyl ester (Z)-|9-Octadecenoic acid (9Z)-, butyl ester|9-Octadecenoic acid, butyl ester, (E)-|9-Octadecenoic acid, butyl ester, (Z)-|AI3-00660|4-02-00-01653 (Beilstein Handbook Reference)
| Molecular Formula | C22H42O2 |
|---|---|
| Molecular Weight | 338.31848 g/mol |
| LogP | 7.3672 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Exact Mass | 338.31848 |
| Monoisotopic Mass | 338.31848 |
| Heavy Atoms | 24 |
| Complexity | 283.6945 |
Chemical Identifiers
| CAS Number | 22147-33-7 |
|---|---|
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCCCC |
Product Overview
(E)-9-Octadecenoic acid butyl ester (CAS 22147-33-7), with molecular formula C22H42O2 and molecular weight 338.31848 g/mol. IUPAC: butyl (E)-octadec-9-enoate.