Glucofuranose, 1:2,5:6-di-O-isopropylidene-3-O-ethyl-, alpha-D-
(5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-ethoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole
Also Known As: 1:2,5:6-Di-O-isopropylidene-3-O-ethyl-alpha-D-glucofuranose|4-19-00-06105 (Beilstein Handbook Reference)|Glucofuranose, 1:2,5:6-di-O-isopropylidene-3-O-ethyl-, alpha-D-|.alpha.-D-Glucofuranose, 3-O-ethyl-1,2:5,6-bis-O-(1-methylethylidene)-|(5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-ethoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole
| Molecular Formula | C14H24O6 |
|---|---|
| Molecular Weight | 288.1573 g/mol |
| LogP | 0.9 |
| Topological Polar Surface Area | 55.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Exact Mass | 288.1573 |
| Monoisotopic Mass | 288.1573 |
| Heavy Atoms | 20 |
| Complexity | 369.0 |
Chemical Identifiers
| CAS Number | 22331-28-8 |
|---|---|
| SMILES | CCO[C@H]1[C@H](OC2C1OC(O2)(C)C)[C@H]3COC(O3)(C)C |
| InChIKey | VZBDKHKADBOBDL-QZWZXBRZSA-N |
Product Overview
Glucofuranose, 1:2,5:6-di-O-isopropylidene-3-O-ethyl-, alpha-D- (CAS 22331-28-8), with molecular formula C14H24O6 and molecular weight 288.1573 g/mol. IUPAC: (5R,6S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-ethoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.