Ethyl 3-methyl-1-benzofuran-2-carboxylate
ethyl 3-methyl-1-benzofuran-2-carboxylate
Also Known As: ethyl 3-methyl-1-benzofuran-2-carboxylate|Ethyl 3-methylbenzofuran-2-carboxylate|3-Methylbenzofuran-2-carboxylic acid ethyl ester|ethyl 3-methylcoumarilate|ChemDiv3_015600|Ethyl 3-Methyl-2-benzifurancarboxylate|KS-00003KCR|TQR0009|3-Fluoro-5-(trifluoromethyl)pyridine|FS-1344|ethyl 3-methylbenzo[d]furan-2-carboxylate|3-methyl-benzofuran-2-carboxylic acid ethyl ester|2-Benzofurancarboxylicacid, 3-methyl-, ethyl ester|3-Methyl-2-benzofurancarboxylic acid ethyl ester|AH-262/31840034|3-METHYLBENZOFURAN-2-CARBOXYLICACIDETHYLESTER|S14-1341
| Molecular Formula | C12H12O3 |
|---|---|
| Molecular Weight | 204.07864 g/mol |
| LogP | 2.91792 |
| Topological Polar Surface Area | 39.44 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 204.07864 |
| Monoisotopic Mass | 204.07864 |
| Heavy Atoms | 15 |
| Complexity | 496.5366 |
Chemical Identifiers
| CAS Number | 22367-82-4 |
|---|---|
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2O1)C |
Product Overview
Ethyl 3-methyl-1-benzofuran-2-carboxylate (CAS 22367-82-4), with molecular formula C12H12O3 and molecular weight 204.07864 g/mol. IUPAC: ethyl 3-methyl-1-benzofuran-2-carboxylate.