L-Iduronic Acid
(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid
Also Known As: L-Iduronic acid|L-idopyranuronic acid|Idopyranuronate|IdoA|glucuronic acid|Hexopyranuronato|L-IdoA|Iduronic acid, L-|L-iduronate|Idopyranuronic Acid|L-iduronic acids|L-Idopyranuronate|IDURONATE|IDURONIC ACID|L-Acid, Sodium Salt|alpha-L-idopyranuronic acid|x-lido-HEX-1:5|6:a|J1.047.082J|(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid|1-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]quinoline,chloride|sodium (1S)-1,5:6,9-dianhydro-8-[(1R,3S,4S,5R)-7-(2-carboxylato-3-hydroxy-4-methylphenyl)-1-ethyl-4-hydroxy-3,5-dimethyl-2-oxoheptyl]-3,4,7,8-tetradeoxy-6-ethyl-2-C-ethyl-1-methyl-L-altro-nonitol
| Molecular Formula | C6H10O7 |
|---|---|
| Molecular Weight | 194.04265 g/mol |
| LogP | -2.3 |
| Topological Polar Surface Area | 127.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Exact Mass | 194.04265 |
| Monoisotopic Mass | 194.04265 |
| Heavy Atoms | 13 |
| Complexity | 205.0 |
Chemical Identifiers
| CAS Number | 2240-07-5 |
|---|---|
| SMILES | [C@@H]1([C@@H]([C@@H](OC([C@@H]1O)O)C(=O)O)O)O |
| InChIKey | AEMOLEFTQBMNLQ-HNFCZKTMSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
L-Iduronic Acid (CAS 2240-07-5), with molecular formula C6H10O7 and molecular weight 194.04265 g/mol. IUPAC: (2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid.