3-(2-Aminoethyl)-5,7-dimethyl-1H-indole-2-carboxylic acid
3-(2-aminoethyl)-5,7-dimethyl-1H-indole-2-carboxylic acid
Also Known As: Oprea1_084270|3-(2-Aminoethyl)-5,7-dimethyl-1H-indole-2-carboxylic acid|5,7-Dimethyltryptamin-2-carbonsaeure|3-(2-aminoethyl)-5,7-dimethylindole-2-carboxylic acid|Indole-2-carboxylic acid, 3-(2-aminoethyl)-5,7-dimethyl-|1H-Indole-2-carboxylic acid, 3-(2-aminoethyl)-5,7-dimethyl-|1h-indole-2-carboxylic acid,3-(2-aminoethyl)-5,7-dimethyl-|3-(2-Aminoethyl)-5,7-dimethyl-1H-indole-2-carboxylic acid #
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.12119 g/mol |
| LogP | -0.3 |
| Topological Polar Surface Area | 79.1 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 232.12119 |
| Monoisotopic Mass | 232.12119 |
| Heavy Atoms | 17 |
| Complexity | 295.0 |
Chemical Identifiers
| CAS Number | 2245-75-2 |
|---|---|
| SMILES | CC1=CC(=C2C(=C1)C(=C(N2)C(=O)O)CCN)C |
| InChIKey | JJPBBLYMQPFDKW-UHFFFAOYSA-N |
Product Overview
3-(2-Aminoethyl)-5,7-dimethyl-1H-indole-2-carboxylic acid (CAS 2245-75-2), with molecular formula C13H16N2O2 and molecular weight 232.12119 g/mol. IUPAC: 3-(2-aminoethyl)-5,7-dimethyl-1H-indole-2-carboxylic acid.
3-(2-Aminoethyl)-5,7-dimethyl-1H-indole-2-carboxylic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »