1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, o-chlorophenylacetate, hydrochloride
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(2-chlorophenyl)acetate;hydrochloride
Also Known As: 3-Tropine o-chlorophenylacetate hydrochloride|3-psi-Tropine o-chlorophenylacetate hydrochloride|1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, o-chlorophenylacetate, hydrochloride|1-alpha-H,5-alpha-H-Tropan-3-beta-ol, o-chlorophenylacetate, hydrochloride|(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(2-chlorophenyl)acetate hydrochloride|8-Methyl-8-azabicyclo[3.2.1]octan-3-yl (2-chlorophenyl)acetate--hydrogen chloride (1/1)
| Molecular Formula | C16H21Cl2NO2 |
|---|---|
| Molecular Weight | 329.09494 g/mol |
| LogP | 3.4727 |
| Topological Polar Surface Area | 29.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 329.09494 |
| Monoisotopic Mass | 329.09494 |
| Heavy Atoms | 21 |
| Complexity | 348.0 |
Chemical Identifiers
| CAS Number | 2247-50-9 |
|---|---|
| SMILES | CN1C2CCC1CC(C2)OC(=O)CC3=CC=CC=C3Cl.Cl |
| InChIKey | KJKUFPFRYPMUPG-UHFFFAOYSA-N |
Product Overview
1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, o-chlorophenylacetate, hydrochloride (CAS 2247-50-9), with molecular formula C16H21Cl2NO2 and molecular weight 329.09494 g/mol. IUPAC: (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(2-chlorophenyl)acetate;hydrochloride.