N-(4-fluorophenyl)-1-(1H-pyrrol-2-yl)methanimine
N-(4-fluorophenyl)-1-(1H-pyrrol-2-yl)methanimine
Also Known As: 4-fluoro-N-(pyrrol-2-ylidenemethyl)aniline|2-[(4-Fluorophenyl)iminomethyl]-1H-pyrrole|J2.788.786D|4-fluoro-N-(1H-pyrrol-2-ylmethylidene)aniline|N-(1H-Pyrrole-2-ylmethylene)-4-fluoroaniline|N-(4-Fluorophenyl)-1H-pyrrole-2-methaneimine|(4-fluorophenyl)(1H-pyrrol-2-ylmethylene)amine|4-fluoro-N-[(Z)-pyrrol-2-ylidenemethyl]aniline|N-(4-fluorophenyl)-1-(1H-pyrrol-2-yl)methanimine
| Molecular Formula | C11H9FN2 |
|---|---|
| Molecular Weight | 188.07498 g/mol |
| LogP | 2.9044 |
| Topological Polar Surface Area | 28.15 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 188.07498 |
| Monoisotopic Mass | 188.07498 |
| Heavy Atoms | 14 |
| Complexity | 415.05798 |
Chemical Identifiers
| CAS Number | 2262-01-3 |
|---|---|
| SMILES | C1=CNC(=C1)C=NC2=CC=C(C=C2)F |
Product Overview
N-(4-fluorophenyl)-1-(1H-pyrrol-2-yl)methanimine (CAS 2262-01-3), with molecular formula C11H9FN2 and molecular weight 188.07498 g/mol. IUPAC: N-(4-fluorophenyl)-1-(1H-pyrrol-2-yl)methanimine.
N-(4-fluorophenyl)-1-(1H-pyrrol-2-yl)methanimine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »