2-Nitro-4-(trifluoromethoxy)aniline
2-nitro-4-(trifluoromethoxy)aniline
Also Known As: 2-Nitro-4-(trifluoromethoxy)aniline|null|Riluzole impurity 18|2-Nitro-4- aniline|ACMC-1CNWP|2-nitro-4-trifluoromethoxyaniline|2-nitro4-trifluoromethoxyaniline|2-Amino-5-(trifluoromethoxy)nitrobenzene|2-nitro-4-trifluoromethoxy-aniline|2-nitro-4-trifluoromethoxy-phenylamine|ACN-S003847|2-nitro-4-(trifluoromethoxy)phenylamine|Benzenamine, 2-nitro-4-(trifluoromethoxy)-|1-Amino-2-nitro-4-(trifluoromethoxy)benzene|3-Nitro-4-aminotrifluoromethoxybenzene|CS-W014725|KS-000009V6
| Molecular Formula | C7H5F3N2O3 |
|---|---|
| Molecular Weight | 222.02522 g/mol |
| LogP | 2.0756 |
| Topological Polar Surface Area | 78.39 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 222.02522 |
| Monoisotopic Mass | 222.02522 |
| Heavy Atoms | 15 |
| Complexity | 391.55707 |
Chemical Identifiers
| CAS Number | 2267-23-4 |
|---|---|
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)[N+](=O)[O-])N |
Product Overview
2-Nitro-4-(trifluoromethoxy)aniline (CAS 2267-23-4), with molecular formula C7H5F3N2O3 and molecular weight 222.02522 g/mol. IUPAC: 2-nitro-4-(trifluoromethoxy)aniline.
2-Nitro-4-(trifluoromethoxy)aniline is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »