Tert-butyl[(4-methoxyphenyl)methyl]amine
N-[(4-methoxyphenyl)methyl]-2-methylpropan-2-amine
Also Known As: N-(tert-butyl)-N-(4-methoxybenzyl)amine|tert-butyl[(4-methoxyphenyl)methyl]amine|N-(4-Methoxyphenylmethyl)tert-butylamine|Oprea1_247722|4-Methoxybenzyl tert-butylamine|N-(p-methoxybenzyl)-t-butylamine|N-tert-Butyl-4-methoxybenzylamine|N-[(4-methoxyphenyl)methyl]-2-methylpropan-2-amine|N-tert-Butyl-4-methoxybenzenemethanamine|tert-butyl((4-methoxyphenyl)methyl)amine|N-(1,1-Dimethylethyl)-4-methoxybenzenemethanamine|(tert-butyl)[(4-methoxyphenyl)methyl]amine|N-[(4-methoxyphenyl)methyl]-2-methyl-propan-2-amine|F1911-1788|993-693-2
| Molecular Formula | C12H19NO |
|---|---|
| Molecular Weight | 193.14667 g/mol |
| LogP | 2.5833 |
| Topological Polar Surface Area | 21.26 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 193.14667 |
| Monoisotopic Mass | 193.14667 |
| Heavy Atoms | 14 |
| Complexity | 271.36835 |
Chemical Identifiers
| CAS Number | 22675-83-8 |
|---|---|
| SMILES | CC(C)(C)NCC1=CC=C(C=C1)OC |
Product Overview
Tert-butyl[(4-methoxyphenyl)methyl]amine (CAS 22675-83-8), with molecular formula C12H19NO and molecular weight 193.14667 g/mol. IUPAC: N-[(4-methoxyphenyl)methyl]-2-methylpropan-2-amine.
Tert-butyl[(4-methoxyphenyl)methyl]amine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »