Oxiranecarboxylic acid, 3-phenyl-, ethyl ester, trans-
ethyl (2S,3R)-3-phenyloxirane-2-carboxylate
Also Known As: Ethyl 3-phenylglycidate|GOMAKLPNAAZVCJ-ZJUUUORDSA-|(2s,3r)-ethyl 3-phenylglycidate|Glycidic acid, ethyl ester, trans-|Oxiranecarboxylic acid, 3-phenyl-, ethyl ester, trans-|Ethyl 3-phenyl-2-oxiranecarboxylate, (E)-|Oxiranecarboxylic acid, ethyl ester, trans-|ethyl (2S,3R)-3-phenyloxirane-2-carboxylate|ethyl (2S,3S)-3-phenyloxirane-2-carboxylate|Glycidic acid, 3-phenyl-, ethyl ester, trans-|Oxiranecarboxylicacid,3-phenyl-,ethylester,trans-|(2S,3R)-3-Phenyloxirane-2-carboxylic acid ethyl ester|(2S)-3beta-Phenyloxirane-2alpha-carboxylic acid ethyl ester|Oxiranecarboxylic acid, 3-phenyl-, ethyl ester, (2S,3R)-|(2alpha,3beta)-3-Phenyl-2-oxiranecarboxylic acid ethyl ester
| Molecular Formula | C11H12O3 |
|---|---|
| Molecular Weight | 192.07864 g/mol |
| LogP | 1.7 |
| Topological Polar Surface Area | 38.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 192.07864 |
| Monoisotopic Mass | 192.07864 |
| Heavy Atoms | 14 |
| Complexity | 209.0 |
Chemical Identifiers
| CAS Number | 2272-49-3 |
|---|---|
| SMILES | CCOC(=O)[C@@H]1[C@H](O1)C2=CC=CC=C2 |
| InChIKey | GOMAKLPNAAZVCJ-ZJUUUORDSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Oxiranecarboxylic acid, 3-phenyl-, ethyl ester, trans- (CAS 2272-49-3), with molecular formula C11H12O3 and molecular weight 192.07864 g/mol. IUPAC: ethyl (2S,3R)-3-phenyloxirane-2-carboxylate.