Ethyl 3-(4-methoxyphenyl)propanoate
ethyl 3-(4-methoxyphenyl)propanoate
Also Known As: Ethyl 3-(4-methoxyphenyl)propanoate|Ethyl-p-methoxyhydrocinnamate|Ethyl 4-methoxybenzenepropanoate|ethyl3-(4-methoxyphenyl)propanoate|3- -PROPIONICACIDETHYLESTER|HY-N3869|3-(4-Methoxyphenyl)propionic acid ethyl ester|ethyl 3-(4-methoxyphenyl)propionate|Ethyl p-methoxyhydrocinnamate; NSC 408331|NP5449|TN4019|Benzenepropanoic acid, 4-methoxy-, ethyl ester|Ethyl 3-(4-methoxyphenyl)propanoate #|Hydrocinnamic acid, p-methoxy-, ethyl ester|4-Methoxybenzenepropanoic acid ethyl ester|4-Methoxybenzenepropionic acid ethyl ester|4CN-0994|3-(4-Methoxy-phenyl)-propionic acid ethyl ester|3-(4-Methoxyphenyl)propanoic acid ethyl ester|Benzenepropanoic acid,4-methoxy-, ethyl ester|ETHYL 3-(4'-METHOXYPHENYL)PROPIONATE|J1.059.064G|3-(4-methoxyphenyl)-propionic acid ethyl ester
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.10994 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 208.10994 |
| Monoisotopic Mass | 208.10994 |
| Heavy Atoms | 15 |
| Complexity | 183.0 |
Chemical Identifiers
| CAS Number | 22767-72-2 |
|---|---|
| SMILES | CCOC(=O)CCC1=CC=C(C=C1)OC |
| InChIKey | BDSDTKZBFYSNLI-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 3-(4-methoxyphenyl)propanoate (CAS 22767-72-2), with molecular formula C12H16O3 and molecular weight 208.10994 g/mol. IUPAC: ethyl 3-(4-methoxyphenyl)propanoate.