2-(Phenylsulfonyl)-1,4-benzenediol
2-(benzenesulfonyl)benzene-1,4-diol
Also Known As: 2-(phenylsulfonyl)-1,4-benzenediol|2-(phenylsulfonyl)benzene-1,4-diol|2-(benzenesulfonyl)benzene-1,4-diol|phenylsulfonylbenzenediol|Bionet2_000305|1,4-Benzenediol, 2-(phenylsulfonyl)-|Oprea1_037423|Oprea1_801763|2-(Phenylsulfonyl)hydroquinone|2- -1,4-BENZENEDIOL|2-phenylsulfonyl-1,4-benzenediol|2-phenylsulfonyl-1,4-dihydroxybenzene|KS-00001RP2|2-Benzenesulfonyl-benzene-1,4-diol|7871AD|Phenyl(2,5-dihydroxyphenyl) sulfone|BAS 01507398|1,4-Benzenediol,2-(phenylsulfonyl)-|Benzene-1,4-diol, 2-benzenesulfonyl-|11G-023|I01-13483|A1956/0082264
| Molecular Formula | C12H10O4S |
|---|---|
| Molecular Weight | 250.02998 g/mol |
| LogP | 2.0 |
| Topological Polar Surface Area | 83.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 250.02998 |
| Monoisotopic Mass | 250.02998 |
| Heavy Atoms | 17 |
| Complexity | 340.0 |
Chemical Identifiers
| CAS Number | 23156-75-4 |
|---|---|
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=C(C=CC(=C2)O)O |
| InChIKey | SXNZCNQISJFAEW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(Phenylsulfonyl)-1,4-benzenediol (CAS 23156-75-4), with molecular formula C12H10O4S and molecular weight 250.02998 g/mol. IUPAC: 2-(benzenesulfonyl)benzene-1,4-diol.