2,6-Di-tert-butyl-4-methylsulfanylcarbothioylphenol
methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate
Also Known As: 2,6-Di-tert-butyl-4-methylsulfanylcarbothioylphenol|methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate|AE-018/31864031|methyl 3,5-ditert-butyl-4-hydroxy-benzenecarbodithioate|Methyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenecarbodithioate|2,6-ditert-butyl-4-[methylsulfanyl(sulfanyl)methylidene]cyclohexa-2,5-dien-1-one
| Molecular Formula | C16H24OS2 |
|---|---|
| Molecular Weight | 296.12686 g/mol |
| LogP | 5.0257 |
| Topological Polar Surface Area | 20.23 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 296.12686 |
| Monoisotopic Mass | 296.12686 |
| Heavy Atoms | 19 |
| Complexity | 455.446 |
Chemical Identifiers
| CAS Number | 2325-07-7 |
|---|---|
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C(=S)SC |
Product Overview
2,6-Di-tert-butyl-4-methylsulfanylcarbothioylphenol (CAS 2325-07-7), with molecular formula C16H24OS2 and molecular weight 296.12686 g/mol. IUPAC: methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate.
2,6-Di-tert-butyl-4-methylsulfanylcarbothioylphenol is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »