ST50216378
2-(4-methoxyphenyl)-4,6-diphenyl-1,3,5-triazine
Also Known As: 2-(4-methoxyphenyl)-4,6-diphenyl-1,3,5-triazine|Oprea1_036547|Oprea1_501438|BAS 00090309|J1.343.811K|2-<4-Methoxyphenyl>-4,6-diphenyl-sym.-triazin|AE-848/32000055|2,4-Diphenyl-6-(4-methoxyphenyl)-1,3,5-triazine|2-(p-Methoxyphenyl)-4,6-diphenyl-1,3,5-triazine|1,3,5-Triazine, 2-(4-methoxyphenyl)-4,6-diphenyl-|2-(4-Methoxy-phenyl)-4,6-diphenyl-[1,3,5]triazine|1-(4,6-diphenyl(1,3,5-triazin-2-yl))-4-methoxybenzene|4-Methoxy-[1,1 ,1 -(1,3,5-triazine-2,4,6-triyl)trisbenzene]
| Molecular Formula | C22H17N3O |
|---|---|
| Molecular Weight | 339.13718 g/mol |
| LogP | 4.9 |
| Topological Polar Surface Area | 47.9 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 339.13718 |
| Monoisotopic Mass | 339.13718 |
| Heavy Atoms | 26 |
| Complexity | 386.0 |
Chemical Identifiers
| CAS Number | 23449-07-2 |
|---|---|
| SMILES | COC1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChIKey | YRRPMAVQIDXZQN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
ST50216378 (CAS 23449-07-2), with molecular formula C22H17N3O and molecular weight 339.13718 g/mol. IUPAC: 2-(4-methoxyphenyl)-4,6-diphenyl-1,3,5-triazine.