4,4'-Stilbenedicarbonyl chloride
4-[(E)-2-(4-carbonochloridoylphenyl)ethenyl]benzoyl chloride
Also Known As: 4,4'-STILBENEDICARBONYL CHLORIDE|Benzoyl chloride, 4,4'-(1,2-ethenediyl)bis-|4,4 -Stilbenedicarboxylic acid dichloride|Benzoyl chloride,4,4'-(1,2-ethenediyl)bis|(E)-4,4'-(ethene-1,2-diyl)dibenzoyl chloride|4-[(E)-2-(4-carbonochloridoylphenyl)ethenyl]benzoyl chloride|4-[2-(4-carbonochloridoylphenyl)ethenyl]benzoyl Chloride|4-{2-[4-(CARBONOCHLORIDOYL)PHENYL]ETHENYL}BENZOYL CHLORIDE|668-096-2
| Molecular Formula | C16H10Cl2O2 |
|---|---|
| Molecular Weight | 304.0058 g/mol |
| LogP | 4.615 |
| Topological Polar Surface Area | 34.14 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 304.0058 |
| Monoisotopic Mass | 304.0058 |
| Heavy Atoms | 20 |
| Complexity | 596.38116 |
Chemical Identifiers
| CAS Number | 23730-63-4 |
|---|---|
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C(=O)Cl)C(=O)Cl |
Product Overview
4,4'-Stilbenedicarbonyl chloride (CAS 23730-63-4), with molecular formula C16H10Cl2O2 and molecular weight 304.0058 g/mol. IUPAC: 4-[(E)-2-(4-carbonochloridoylphenyl)ethenyl]benzoyl chloride.
4,4'-Stilbenedicarbonyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »