3,5,6-Trichloroperfluorohexanoic acid
3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid
Also Known As: 3,5,6-Trichlorooctafluorohexanoic acid|3,5,6-Trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid|C6HCl3F8O2|3,5,6-Trichloroperfluorohexanoic acid|Perfluoro-3,5,6-trichlorohexanoic acid|3,5,6-Trichlorooctafluorohexanoicacid|3,5,6-trichloro-octafluoro-hexanoic acid|Perfluoro-3,5,6-trichlorohexanoic acid 97%|Hexanoic acid, 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluoro-|I04-0393|3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluoro hexanoic acid|Hexanoic acid,3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluoro-|3,5,6-Trichlorooctafluorohexanoic acid, 2,2,3,4,4,5,6,6-Octafluoro-3,5,6-trichlorohexanoic acid|640-690-6
| Molecular Formula | C6HCl3F8O2 |
|---|---|
| Molecular Weight | 361.89145 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Exact Mass | 361.89145 |
| Monoisotopic Mass | 361.89145 |
| Heavy Atoms | 19 |
| Complexity | 391.0 |
Chemical Identifiers
| CAS Number | 23903-48-2 |
|---|---|
| SMILES | C(=O)(C(C(C(C(C(F)(F)Cl)(F)Cl)(F)F)(F)Cl)(F)F)O |
| InChIKey | ANRGSWRBGXZQLY-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3,5,6-Trichloroperfluorohexanoic acid (CAS 23903-48-2), with molecular formula C6HCl3F8O2 and molecular weight 361.89145 g/mol. IUPAC: 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid.