2,6-Dichlorobenzenesulfonylchloride
2,6-dichlorobenzenesulfonyl chloride
Also Known As: 2,6-Dichlorobenzenesulfonyl chloride|2,6-dichlorobenzene-1-sulfonyl chloride|2,6-Dichlorobenzenesulfonylchloride|null|2,6-dichlorophenylsulfonyl chloride|ACMC-209ns8|2,6-Dichlorobenzenesulphonyl chloride|BENZENESULFONYL CHLORIDE, 2,6-DICHLORO-|2,6-dichloro-benzenesulfonyl chloride|(2,6-dichlorophenyl)chlorosulfone|BUTTPARK 37\11-63|ACN-S002591|KS-00000W4P|2,6-dichlorobenzenesulfonyl-chloride|Tox21_202863|2,6-DICHLOROSULPHONYLCHLORIDE|CK2506|2,6-dichlorobenzene sulfonyl chloride|2,6-dichlorobenzene-sulfonyl chloride|AN-6009|CS-W010248|N-(1-CYCLOHEPTYLETHYL)BENZYLAMINE|NCGC00260409-01
| Molecular Formula | C6H3Cl3O2S |
|---|---|
| Molecular Weight | 243.89194 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 42.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 243.89194 |
| Monoisotopic Mass | 243.89194 |
| Heavy Atoms | 12 |
| Complexity | 236.0 |
Chemical Identifiers
| CAS Number | 239087-08-2 |
|---|---|
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)Cl |
| InChIKey | WGGKQIKICKLWGN-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 10 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,6-Dichlorobenzenesulfonylchloride (CAS 239087-08-2), with molecular formula C6H3Cl3O2S and molecular weight 243.89194 g/mol. IUPAC: 2,6-dichlorobenzenesulfonyl chloride.