6-Phenyl-1,2,4-triazine-3,5(2h,4h)-dione
6-phenyl-2H-1,2,4-triazine-3,5-dione
Also Known As: 5-phenyl-6-azauracil|6-phenyl-1,2,4-triazine-3,5(2h,4h)-dione|ChemDiv1_021916|Oprea1_067765|Oprea1_575284|HMS649E04|6-phenyl-1,2,4-triazine-3,5-diol|6-phenyl-2H-1,2,4-triazine-3,5-dione|6-Phenyl-1,2,4-triazine-3,5-dione|1,2,4-Triazine-3,5(2H,4H)-dione,6-phenyl-|6-Phenyl-2H-[1,2,4]triazine-3,5-dione|6-phenyl-2H,4H-1,2,4-triazine-3,5-dione|6-phenyl-1,2,4-triazine-3,5-(2H,4H)-dione|AG-690/12886769|1,2,4-Triazine-3,5-(2H,4H)-dione, 6-phenyl-|6-phenyl-2,3,4,5-tetrahydro-1,2,4-triazine-3,5-dione|SR-01000438015-1|F0910-2252
| Molecular Formula | C9H7N3O2 |
|---|---|
| Molecular Weight | 189.05383 g/mol |
| LogP | 0.7 |
| Topological Polar Surface Area | 70.6 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 189.05383 |
| Monoisotopic Mass | 189.05383 |
| Heavy Atoms | 14 |
| Complexity | 292.0 |
Chemical Identifiers
| CAS Number | 23969-93-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=NNC(=O)NC2=O |
| InChIKey | QDVLVVJHFWNNJK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
6-Phenyl-1,2,4-triazine-3,5(2h,4h)-dione (CAS 23969-93-9), with molecular formula C9H7N3O2 and molecular weight 189.05383 g/mol. IUPAC: 6-phenyl-2H-1,2,4-triazine-3,5-dione.