2,3-Dihydro-3-hydroxy-2-phenyl-4H-1,3-benzoxazin-4-one
3-hydroxy-2-phenyl-2H-1,3-benzoxazin-4-one
Also Known As: Oprea1_361064|2,3-Dihydro-3-hydroxy-2-phenyl-4H-1,3-benzoxazin-4-one|3-hydroxy-2-phenyl-2H-1,3-benzoxazin-4-one|4H-1,3-Benzoxazin-4-one, 2,3-dihydro-3-hydroxy-2-phenyl-|3-hydroxy-2-phenyl-2H-benzo[e][1,3]oxazin-4(3H)-one|3-Hydroxy-2-phenyl-2,3-dihydro-4H-1,3-benzoxazin-4-one|3-hydroxy-2-phenyl-2,3-dihydro-benz[e][1,3]oxazin-4-one|4H-1,3-Benzoxazin-4-one,2,3-dihydro-3-hydroxy-2-phenyl-
| Molecular Formula | C14H11NO3 |
|---|---|
| Molecular Weight | 241.0739 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 49.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 241.0739 |
| Monoisotopic Mass | 241.0739 |
| Heavy Atoms | 18 |
| Complexity | 314.0 |
Chemical Identifiers
| CAS Number | 23979-92-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2N(C(=O)C3=CC=CC=C3O2)O |
| InChIKey | REYPFGVUOUTVNT-UHFFFAOYSA-N |
Product Overview
2,3-Dihydro-3-hydroxy-2-phenyl-4H-1,3-benzoxazin-4-one (CAS 23979-92-2), with molecular formula C14H11NO3 and molecular weight 241.0739 g/mol. IUPAC: 3-hydroxy-2-phenyl-2H-1,3-benzoxazin-4-one.
2,3-Dihydro-3-hydroxy-2-phenyl-4H-1,3-benzoxazin-4-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »