AC1L4OOB
4-(5-ethyl-3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-N,N-dimethylaniline iodide
Also Known As: 2-(p-(Dimethylamino)phenyl)-5-ethyl-3,4-dimethyl-thiazolium iodide|2-[4-(dimethylamino)phenyl]-5-ethyl-3,4-dimethyl-1,3-thiazol-3-ium iodide|Thiazolium, 2-(p-(dimethylamino)phenyl)-5-ethyl-3,4-dimethyl-, iodide|2-
| Molecular Formula | C15H21IN2S |
|---|---|
| Molecular Weight | 388.04703 g/mol |
| LogP | 0.18042 |
| Topological Polar Surface Area | 35.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 388.04703 |
| Monoisotopic Mass | 388.04703 |
| Heavy Atoms | 19 |
| Complexity | 261.0 |
Chemical Identifiers
| CAS Number | 24239-79-0 |
|---|---|
| SMILES | CCC1=C([N+](=C(S1)C2=CC=C(C=C2)N(C)C)C)C.[I-] |
| InChIKey | DANVIHPKWFBTPE-UHFFFAOYSA-M |
Product Overview
AC1L4OOB (CAS 24239-79-0), with molecular formula C15H21IN2S and molecular weight 388.04703 g/mol. IUPAC: 4-(5-ethyl-3,4-dimethyl-1,3-thiazol-3-ium-2-yl)-N,N-dimethylaniline iodide.