![Diethyl [(4-hydroxy-3-methoxyphenyl)methylidene]propanedioate structure](/static/products/2433/24331-83-7.webp)
Diethyl [(4-hydroxy-3-methoxyphenyl)methylidene]propanedioate
diethyl 2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanedioate
Also Known As: Vanillalmalonsaeure-diaethylester|diethyl 2-(4-hydroxy-3-methoxybenzylidene)malonate|J1.607.336I|Propanedioic acid,2-[(4-hydroxy-3-methoxyphenyl)methylene]-, 1,3-diethyl ester|Diethyl [(4-hydroxy-3-methoxyphenyl)methylidene]propanedioate|diethyl 2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanedioate|2-(3-Methoxy-4-hydroxybenzylidene)malonic acid diethyl ester|2-(4-Hydroxy-3-methoxybenzylidene)malonic acid diethyl ester|1,3-DIETHYL 2-[(4-HYDROXY-3-METHOXYPHENYL)METHYLIDENE]PROPANEDIOATE
| Molecular Formula | C15H18O6 |
|---|---|
| Molecular Weight | 294.11035 g/mol |
| LogP | 2.9 |
| Topological Polar Surface Area | 82.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Exact Mass | 294.11035 |
| Monoisotopic Mass | 294.11035 |
| Heavy Atoms | 21 |
| Complexity | 370.0 |
Chemical Identifiers
| CAS Number | 24331-83-7 |
|---|---|
| SMILES | CCOC(=O)C(=CC1=CC(=C(C=C1)O)OC)C(=O)OCC |
| InChIKey | PLTKCENRRRYKPI-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Diethyl [(4-hydroxy-3-methoxyphenyl)methylidene]propanedioate (CAS 24331-83-7), with molecular formula C15H18O6 and molecular weight 294.11035 g/mol. IUPAC: diethyl 2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanedioate.