Isopropyl N-(2,5-dichlorophenyl)carbamate
propan-2-yl N-(2,5-dichlorophenyl)carbamate
Also Known As: propan-2-yl N-(2,5-dichlorophenyl)carbamate|propan-2-yl(2,5-dichlorophenyl)carbamate|Isopropyl (2,5-dichlorophenyl)carbamate|ISOPROPYL N-(2,5-DICHLOROPHENYL)CARBAMATE|2,5-Dichlorocarbanilic acid isopropyl ester|J1.581.961H|(2,5-Dichlor-phenyl)-carbamidsaeure-isopropylester|(2,5-dichloro-phenyl)-carbamic acid isopropyl ester|Propan-2-yl hydrogen (2,5-dichlorophenyl)carbonimidate|Carbamic acid, N-(2,5-dichlorophenyl)-, 1-methylethyl ester|667-542-3
| Molecular Formula | C10H11Cl2NO2 |
|---|---|
| Molecular Weight | 247.01668 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 38.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 247.01668 |
| Monoisotopic Mass | 247.01668 |
| Heavy Atoms | 15 |
| Complexity | 223.0 |
Chemical Identifiers
| CAS Number | 24614-75-3 |
|---|---|
| SMILES | CC(C)OC(=O)NC1=C(C=CC(=C1)Cl)Cl |
| InChIKey | JNQVFBWQRGWFHG-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Isopropyl N-(2,5-dichlorophenyl)carbamate (CAS 24614-75-3), with molecular formula C10H11Cl2NO2 and molecular weight 247.01668 g/mol. IUPAC: propan-2-yl N-(2,5-dichlorophenyl)carbamate.