6'-Methyl-2'-acetonaphthone
1-(6-methylnaphthalen-2-yl)ethanone
Also Known As: 6'-Methyl-2'-acetonaphthone|2-methyl-6-acetylnaphthalene|1-(6-methylnaphthalen-2-yl)ethanone|2-acetyl-6-methylnaphthalene|1-(6-Methyl-2-naphthyl)ethanone|1-(6-methylnaphthalen-2-yl)ethan-1-one|1-(6-Methyl-2-naphthalenyl)ethanone|6-ACETYL-2-METHYLNAPHTHALENE|6-METHYL-2-ACETONAPHTHONE|6-Methyl-2-naphthyl(methyl) ketone|1-(6-methyl-naphthalen-2-yl)-ethanone|1-(6-Methyl-2-naphthyl)ethanone #|6'-Methyl-2'-acetonaphthone, 98%|Ethanone, 1-(6-methyl-2-naphthalenyl)-|I14-46337|6 inverted exclamation marka-Methyl-2 inverted exclamation marka-acetonaphthone
| Molecular Formula | C13H12O |
|---|---|
| Molecular Weight | 184.08882 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 184.08882 |
| Monoisotopic Mass | 184.08882 |
| Heavy Atoms | 14 |
| Complexity | 221.0 |
Chemical Identifiers
| CAS Number | 24875-94-3 |
|---|---|
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)C(=O)C |
| InChIKey | SPAYGOAEIJHIDE-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
6'-Methyl-2'-acetonaphthone (CAS 24875-94-3), with molecular formula C13H12O and molecular weight 184.08882 g/mol. IUPAC: 1-(6-methylnaphthalen-2-yl)ethanone.
6'-Methyl-2'-acetonaphthone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »