3-(4-Chlorophenyl)-N,N-dimethylbutan-2-amine--hydrogen chloride (1/1)
3-(4-chlorophenyl)-N,N-dimethylbutan-2-amine;hydrochloride
Also Known As: B 1288|3-(p-Chlorophenyl)-N,N-dimethyl-2-butylamine hydrochloride|2-Butylamine, 3-(p-chlorophenyl)-N,N-dimethyl-, hydrochloride|3-(4-chlorophenyl)-n,n-dimethylbutan-2-amine hydrochloride(1:1)|3-(4-chlorophenyl)-N,N-dimethylbutan-2-amine hydrochloride|Phenethylamine, 4-chloro-alpha,beta,N,N-tetramethyl-, hydrochloride|3-(4-Chlorophenyl)-N,N-dimethylbutan-2-amine--hydrogen chloride (1/1)
| Molecular Formula | C12H19Cl2N |
|---|---|
| Molecular Weight | 247.08946 g/mol |
| LogP | 3.8154 |
| Topological Polar Surface Area | 3.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 247.08946 |
| Monoisotopic Mass | 247.08946 |
| Heavy Atoms | 15 |
| Complexity | 162.0 |
Chemical Identifiers
| CAS Number | 24980-96-9 |
|---|---|
| SMILES | CC(C1=CC=C(C=C1)Cl)C(C)N(C)C.Cl |
| InChIKey | ZAZWEXMSDYEFTO-UHFFFAOYSA-N |
Product Overview
3-(4-Chlorophenyl)-N,N-dimethylbutan-2-amine--hydrogen chloride (1/1) (CAS 24980-96-9), with molecular formula C12H19Cl2N and molecular weight 247.08946 g/mol. IUPAC: 3-(4-chlorophenyl)-N,N-dimethylbutan-2-amine;hydrochloride.
3-(4-Chlorophenyl)-N,N-dimethylbutan-2-amine--hydrogen chloride (1/1) is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »