Alanine, N-benzyl methyl ester, L-
methyl 2-[[3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate
Also Known As: Z-Thr-Ala-OMe|L-Alanine, methyl ester|Alanine, N-benzyl methyl ester, L-|N-Phenylmethoxycarbonyl-L-Thr-L-Ala-OMe|methyl n-[(benzyloxy)carbonyl]threonylalaninate|Alanine, N-(N-carboxy-L-threonyl)-, N-benzyl methyl ester, L-|L-Alanine, N-[N-[(phenylmethoxy)carbonyl]-L-threonyl]-, methyl ester|methyl 2-[[3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate|2-{[(Benzyloxy)(hydroxy)methylidene]amino}-3-hydroxy-N-(1-methoxy-1-oxopropan-2-yl)butanimidic acid
| Molecular Formula | C16H22N2O6 |
|---|---|
| Molecular Weight | 338.1478 g/mol |
| LogP | 0.9 |
| Topological Polar Surface Area | 114.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Exact Mass | 338.1478 |
| Monoisotopic Mass | 338.1478 |
| Heavy Atoms | 24 |
| Complexity | 436.0 |
Chemical Identifiers
| CAS Number | 2499-31-2 |
|---|---|
| SMILES | CC(C(C(=O)NC(C)C(=O)OC)NC(=O)OCC1=CC=CC=C1)O |
| InChIKey | TYQCBAAOCMMFDK-UHFFFAOYSA-N |
Product Overview
Alanine, N-benzyl methyl ester, L- (CAS 2499-31-2), with molecular formula C16H22N2O6 and molecular weight 338.1478 g/mol. IUPAC: methyl 2-[[3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate.