5-Chloro-2-hydroxybenzene-1-sulfonyl chloride
5-chloro-2-hydroxybenzenesulfonyl chloride
Also Known As: 5-chloro-2-hydroxybenzenesulfonyl chloride|5-chloro-2-hydroxybenzene-1-sulfonyl chloride|Benzenesulfonyl chloride, 5-chloro-2-hydroxy-|2-Hydroxy-5-chlorobenzene sulfonyl chloride|5-chloro-2-hydroxy-benzenesulfonyl Chloride|Benzenesulfonyl chloride,5-chloro-2-hydroxy|5-chloro-2-hydroxybenzene-1-sulfonylchloride|842-937-5
| Molecular Formula | C6H4Cl2O3S |
|---|---|
| Molecular Weight | 225.92583 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 62.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 225.92583 |
| Monoisotopic Mass | 225.92583 |
| Heavy Atoms | 12 |
| Complexity | 246.0 |
Chemical Identifiers
| CAS Number | 25319-95-3 |
|---|---|
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)Cl)O |
| InChIKey | ZFZMINYPHAEJGW-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
5-Chloro-2-hydroxybenzene-1-sulfonyl chloride (CAS 25319-95-3), with molecular formula C6H4Cl2O3S and molecular weight 225.92583 g/mol. IUPAC: 5-chloro-2-hydroxybenzenesulfonyl chloride.
5-Chloro-2-hydroxybenzene-1-sulfonyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »