Xylulose-1-phosphate
[(3S,4R)-3,4,5-trihydroxy-2-oxopentyl] dihydrogen phosphate
Also Known As: D-Xylulose 1-phosphate|Phosphoxylulose|Xylulose-1-phosphate|D-ribulose-1-P|D-Xylulose1-phosphate|1-O-phosphono-D-xylulose|L-threo-Pentulose 1-phosphate|1-O-Phosphonopent-2-ulose|1-phosphate-D-threo-Pentulose|1-(dihydrogen phosphate) D-threo-Pentulose|L-threo-2-Pentulose, 1-(dihydrogen phosphate)|(3S,4R)-3,4,5-Trihydroxy-2-oxopentyl dihydrogen phosphate|[(3S,4R)-3,4,5-trihydroxy-2-oxopentyl] dihydrogen phosphate|[(3S,4R)-3,4,5-trihydroxy-2-oxo-pentyl] dihydrogen phosphate
| Molecular Formula | C5H11O8P |
|---|---|
| Molecular Weight | 230.01915 g/mol |
| LogP | -3.7 |
| Topological Polar Surface Area | 145.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Exact Mass | 230.01915 |
| Monoisotopic Mass | 230.01915 |
| Heavy Atoms | 14 |
| Complexity | 234.0 |
Chemical Identifiers
| CAS Number | 2547-08-2 |
|---|---|
| SMILES | C([C@H]([C@@H](C(=O)COP(=O)(O)O)O)O)O |
| InChIKey | NBOCCPQHBPGYCX-WUJLRWPWSA-N |
Patent-Derived Application Labels
Derived from 11 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Xylulose-1-phosphate (CAS 2547-08-2), with molecular formula C5H11O8P and molecular weight 230.01915 g/mol. IUPAC: [(3S,4R)-3,4,5-trihydroxy-2-oxopentyl] dihydrogen phosphate.