Methanone, (2-hydroxyphenyl)(3-phenyloxiranyl)-
(2-hydroxyphenyl)-(3-phenyloxiran-2-yl)methanone
Also Known As: 2'-Hydroxychalcon-epoxid|Phenol, 2-[(3-phenyloxiranyl)carbonyl]-|2-Hydroxyphenyl(3-phenyloxiranyl) ketone|Methanone, (2-hydroxyphenyl)(3-phenyloxiranyl)-|(2-hydroxyphenyl)-(3-phenyloxiran-2-yl)methanone|2-(3-PHENYLOXIRANE-2-CARBONYL)PHENOL|J2.152.808K|(2-Hydroxyphenyl)(3-phenyloxiran-2-yl)methanone|(2-Hydroxyphenyl)(3-phenyl-2-oxiranyl)methanone #
| Molecular Formula | C15H12O3 |
|---|---|
| Molecular Weight | 240.07864 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 49.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 240.07864 |
| Monoisotopic Mass | 240.07864 |
| Heavy Atoms | 18 |
| Complexity | 309.0 |
Chemical Identifiers
| CAS Number | 25518-22-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2C(O2)C(=O)C3=CC=CC=C3O |
| InChIKey | WTHRQTPREPZROJ-UHFFFAOYSA-N |
Product Overview
Methanone, (2-hydroxyphenyl)(3-phenyloxiranyl)- (CAS 25518-22-3), with molecular formula C15H12O3 and molecular weight 240.07864 g/mol. IUPAC: (2-hydroxyphenyl)-(3-phenyloxiran-2-yl)methanone.
Methanone, (2-hydroxyphenyl)(3-phenyloxiranyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »