2,3-Dibromo-tert-butyl-p-benzoquinone
2,3-dibromo-5-tert-butylcyclohexa-2,5-diene-1,4-dione
Also Known As: 2,3-Dibromo-tert-butyl-p-benzoquinone|2,3-dibromo-5-tert-butylcyclohexa-2,5-diene-1,4-dione|2,3-Dibromo-5-tert-butyl-2,5-cyclohexadiene-1,4-dione|2-tert-Butyl-5,6-dibromo-2,5-cyclohexadiene-1,4-dione|2,3-dibromo-5-tert-butyl-cyclohexa-2,5-diene-1,4-dione|2,5-Cyclohexadiene-1,4-dione, 2,3-dibromo-5-(1,1-dimethylethyl)-|2,5-CYCLOHEXADIENE-1,4-DIONE,2,3-DIBROMO-5-(1,1-DIMETHYLETHYL)-
| Molecular Formula | C10H10Br2O2 |
|---|---|
| Molecular Weight | 319.90475 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 34.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 319.90475 |
| Monoisotopic Mass | 319.90475 |
| Heavy Atoms | 14 |
| Complexity | 370.0 |
Chemical Identifiers
| CAS Number | 25762-86-1 |
|---|---|
| SMILES | CC(C)(C)C1=CC(=O)C(=C(C1=O)Br)Br |
| InChIKey | HCBKPGGQJQJYLJ-UHFFFAOYSA-N |
Product Overview
2,3-Dibromo-tert-butyl-p-benzoquinone (CAS 25762-86-1), with molecular formula C10H10Br2O2 and molecular weight 319.90475 g/mol. IUPAC: 2,3-dibromo-5-tert-butylcyclohexa-2,5-diene-1,4-dione.
2,3-Dibromo-tert-butyl-p-benzoquinone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »