Diethyl [(4-methylphenyl)(phenylamino)methyl]phosphonate
N-[diethoxyphosphoryl-(4-methylphenyl)methyl]aniline
Also Known As: J1.555.457F|N-[diethoxyphosphoryl-(4-methylphenyl)methyl]aniline|diethyl ((phenylamino)(p-tolyl)methyl)phosphonate|diethyl [(4-methylphenyl)(phenylamino)methyl]phosphonate|N-[alpha-(Diethoxyphosphinyl)-4-methylbenzyl]aniline|alpha-Anilino-4-methylbenzylphosphonic acid diethyl ester|p-Methyl-alpha-anilinobenzylphosphonic acid diethyl ester|(4-Methyl-alpha-anilinobenzyl)phosphonic acid diethyl ester|(alpha-Anilino-4-methylbenzyl)phosphonic acid diethyl ester|4-Methyl-alpha-(phenylamino)benzylphosphonic acid diethyl ester|alpha-(Phenylamino)-4-methylbenzylphosphonic acid diethyl ester|[alpha-(Phenylamino)-4-methylbenzyl]phosphonic acid diethyl ester
| Molecular Formula | C18H24NO3P |
|---|---|
| Molecular Weight | 333.14938 g/mol |
| LogP | 5.37182 |
| Topological Polar Surface Area | 47.56 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Exact Mass | 333.14938 |
| Monoisotopic Mass | 333.14938 |
| Heavy Atoms | 23 |
| Complexity | 633.0761 |
Chemical Identifiers
| CAS Number | 26321-53-9 |
|---|---|
| SMILES | CCOP(=O)(C(C1=CC=C(C=C1)C)NC2=CC=CC=C2)OCC |
Product Overview
Diethyl [(4-methylphenyl)(phenylamino)methyl]phosphonate (CAS 26321-53-9), with molecular formula C18H24NO3P and molecular weight 333.14938 g/mol. IUPAC: N-[diethoxyphosphoryl-(4-methylphenyl)methyl]aniline.